C13H16F3N3O — CID 79964395
2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-1,3-benzoxazol-5-amine (PubChem CID 79964395) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79964395 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-1,3-benzoxazol-5-amine |
| SMILES | CC(C)N(Cc1nc2cc(N)ccc2o1)CC(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O/c1-8(2)19(7-13(14,15)16)6-12-18-10-5-9(17)3-4-11(10)20-12/h3-5,8H,6-7,17H2,1-2H3 |
| InChIKey | QXCFBVDRKAWSGY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|