C14H21N3O2 — CID 79995091
2-[[ethyl(1-methoxypropan-2-yl)amino]methyl]-1,3-benzoxazol-6-amine (PubChem CID 79995091) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[[ethyl(1-methoxypropan-2-yl)amino]methyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[[ethyl(1-methoxypropan-2-yl)amino]methyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79995091 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-[[ethyl(1-methoxypropan-2-yl)amino]methyl]-1,3-benzoxazol-6-amine |
| SMILES | CCN(Cc1nc2ccc(N)cc2o1)C(C)COC |
| InChI | InChI=1S/C14H21N3O2/c1-4-17(10(2)9-18-3)8-14-16-12-6-5-11(15)7-13(12)19-14/h5-7,10H,4,8-9,15H2,1-3H3 |
| InChIKey | YGXNHQOHLSFBLG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|