C14H20N2O3 — CID 106665121
2-[(3-methoxy-3-methylbutoxy)methyl]-1,3-benzoxazol-5-amine (PubChem CID 106665121) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[(3-methoxy-3-methylbutoxy)methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3-methoxy-3-methylbutoxy)methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 106665121 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[(3-methoxy-3-methylbutoxy)methyl]-1,3-benzoxazol-5-amine |
| SMILES | COC(C)(C)CCOCc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,17-3)6-7-18-9-13-16-11-8-10(15)4-5-12(11)19-13/h4-5,8H,6-7,9,15H2,1-3H3 |
| InChIKey | HHUIVRMUAZFNJV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|