C14H9Cl3N2O2 — CID 79960349
2-[(2,4,5-trichlorophenoxy)methyl]-1,3-benzoxazol-5-amine (PubChem CID 79960349) has the molecular formula C14H9Cl3N2O2 and a molecular weight of 343.60 g/mol. Its IUPAC name is 2-[(2,4,5-trichlorophenoxy)methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(2,4,5-trichlorophenoxy)methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79960349 |
| Molecular Formula | C14H9Cl3N2O2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-[(2,4,5-trichlorophenoxy)methyl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(COc3cc(Cl)c(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C14H9Cl3N2O2/c15-8-4-10(17)13(5-9(8)16)20-6-14-19-11-3-7(18)1-2-12(11)21-14/h1-5H,6,18H2 |
| InChIKey | CTWQKLYZKGUXPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|