C15H20N2OS — CID 64745304
2-(3,4-dimethylcyclohexyl)oxy-1,3-benzothiazol-6-amine (PubChem CID 64745304) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)oxy-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3,4-dimethylcyclohexyl)oxy-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 64745304 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)oxy-1,3-benzothiazol-6-amine |
| SMILES | CC1CCC(Oc2nc3ccc(N)cc3s2)CC1C |
| InChI | InChI=1S/C15H20N2OS/c1-9-3-5-12(7-10(9)2)18-15-17-13-6-4-11(16)8-14(13)19-15/h4,6,8-10,12H,3,5,7,16H2,1-2H3 |
| InChIKey | VNEUPIUCBJRSJU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|