C13H9BrN2OS — CID 55175741
2-(4-bromophenoxy)-1,3-benzothiazol-6-amine (PubChem CID 55175741) has the molecular formula C13H9BrN2OS and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(4-bromophenoxy)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 55175741 |
| Molecular Formula | C13H9BrN2OS |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 2-(4-bromophenoxy)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(Oc3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C13H9BrN2OS/c14-8-1-4-10(5-2-8)17-13-16-11-6-3-9(15)7-12(11)18-13/h1-7H,15H2 |
| InChIKey | WDGOMIBLJSFWFD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|