C12H14N2O3 — CID 79999271
2-(oxolan-3-yloxymethyl)-1,3-benzoxazol-6-amine (PubChem CID 79999271) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(oxolan-3-yloxymethyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(oxolan-3-yloxymethyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79999271 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(oxolan-3-yloxymethyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(COC3CCOC3)oc2c1 |
| InChI | InChI=1S/C12H14N2O3/c13-8-1-2-10-11(5-8)17-12(14-10)7-16-9-3-4-15-6-9/h1-2,5,9H,3-4,6-7,13H2 |
| InChIKey | NETUCAQZBVXHQZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|