C17H24N2O2 — CID 79960358
2-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine (PubChem CID 79960358) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79960358 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine |
| SMILES | CC1CC(OCc2nc3cc(N)ccc3o2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-11-6-13(9-17(2,3)8-11)20-10-16-19-14-7-12(18)4-5-15(14)21-16/h4-5,7,11,13H,6,8-10,18H2,1-3H3 |
| InChIKey | VKGRTLMTZFAXAG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|