C15H25N3O — CID 62464142
[4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-2-pyridinyl]hydrazine (PubChem CID 62464142) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is [4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-2-pyridinyl]hydrazine.
| Compound Name | [4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62464142 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | [4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-2-pyridinyl]hydrazine |
| SMILES | CC1CC(OCc2ccnc(NN)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H25N3O/c1-11-6-13(9-15(2,3)8-11)19-10-12-4-5-17-14(7-12)18-16/h4-5,7,11,13H,6,8-10,16H2,1-3H3,(H,17,18) |
| InChIKey | VZGZFKORSYCAAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|