C13H13N3O3 — CID 79996077
1-[(6-amino-1,3-benzoxazol-2-yl)methyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 79996077) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-[(6-amino-1,3-benzoxazol-2-yl)methyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[(6-amino-1,3-benzoxazol-2-yl)methyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79996077 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[(6-amino-1,3-benzoxazol-2-yl)methyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(Cc2nc3ccc(N)cc3o2)C1=O |
| InChI | InChI=1S/C13H13N3O3/c1-7-4-12(17)16(13(7)18)6-11-15-9-3-2-8(14)5-10(9)19-11/h2-3,5,7H,4,6,14H2,1H3 |
| InChIKey | MYZGCQKNNSDAGU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|