C11H10N4O3 — CID 79995104
3-[(6-amino-1,3-benzoxazol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 79995104) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzoxazol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(6-amino-1,3-benzoxazol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79995104 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-[(6-amino-1,3-benzoxazol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Nc1ccc2nc(CN3C(=O)CNC3=O)oc2c1 |
| InChI | InChI=1S/C11H10N4O3/c12-6-1-2-7-8(3-6)18-9(14-7)5-15-10(16)4-13-11(15)17/h1-3H,4-5,12H2,(H,13,17) |
| InChIKey | UAPKKAKVDKJGMI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|