C15H21N3O2 — CID 79995080
2-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-1,3-benzoxazol-6-amine (PubChem CID 79995080) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79995080 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-1,3-benzoxazol-6-amine |
| SMILES | CCC1COC(C)CN1Cc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-12-9-19-10(2)7-18(12)8-15-17-13-5-4-11(16)6-14(13)20-15/h4-6,10,12H,3,7-9,16H2,1-2H3 |
| InChIKey | VMQVKSLRZDVKLH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|