C14H12N2O3S — CID 79999527
2-(benzenesulfonylmethyl)-1,3-benzoxazol-6-amine (PubChem CID 79999527) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(benzenesulfonylmethyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79999527 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(CS(=O)(=O)c3ccccc3)oc2c1 |
| InChI | InChI=1S/C14H12N2O3S/c15-10-6-7-12-13(8-10)19-14(16-12)9-20(17,18)11-4-2-1-3-5-11/h1-8H,9,15H2 |
| InChIKey | LGDDNXLWZXZLTM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|