C15H14N2O — CID 43152427
2-[(4-methylphenyl)methyl]-1,3-benzoxazol-6-amine (PubChem CID 43152427) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[(4-methylphenyl)methyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 43152427 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1,3-benzoxazol-6-amine |
| SMILES | Cc1ccc(Cc2nc3ccc(N)cc3o2)cc1 |
| InChI | InChI=1S/C15H14N2O/c1-10-2-4-11(5-3-10)8-15-17-13-7-6-12(16)9-14(13)18-15/h2-7,9H,8,16H2,1H3 |
| InChIKey | DKBKOWBUMKDDFR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|