C16H14ClNO — CID 142008394
2-[[4-(chloromethyl)phenyl]methyl]-5-methyl-1,3-benzoxazole (PubChem CID 142008394) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)phenyl]methyl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[[4-(chloromethyl)phenyl]methyl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 142008394 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[[4-(chloromethyl)phenyl]methyl]-5-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(Cc3ccc(CCl)cc3)nc2c1 |
| InChI | InChI=1S/C16H14ClNO/c1-11-2-7-15-14(8-11)18-16(19-15)9-12-3-5-13(10-17)6-4-12/h2-8H,9-10H2,1H3 |
| InChIKey | QDMQCASBKUBWFF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|