C19H21NO — CID 53418563
5-tert-butyl-2-[(3-methylphenyl)methyl]-1,3-benzoxazole (PubChem CID 53418563) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-tert-butyl-2-[(3-methylphenyl)methyl]-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-[(3-methylphenyl)methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 53418563 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-tert-butyl-2-[(3-methylphenyl)methyl]-1,3-benzoxazole |
| SMILES | Cc1cccc(Cc2nc3cc(C(C)(C)C)ccc3o2)c1 |
| InChI | InChI=1S/C19H21NO/c1-13-6-5-7-14(10-13)11-18-20-16-12-15(19(2,3)4)8-9-17(16)21-18/h5-10,12H,11H2,1-4H3 |
| InChIKey | LKXWMGDXLMQBEI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |