C19H21NO — CID 46089173
5-tert-butyl-2-(2,5-dimethylphenyl)-1,3-benzoxazole (PubChem CID 46089173) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,5-dimethylphenyl)-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-(2,5-dimethylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 46089173 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-tert-butyl-2-(2,5-dimethylphenyl)-1,3-benzoxazole |
| SMILES | Cc1ccc(C)c(-c2nc3cc(C(C)(C)C)ccc3o2)c1 |
| InChI | InChI=1S/C19H21NO/c1-12-6-7-13(2)15(10-12)18-20-16-11-14(19(3,4)5)8-9-17(16)21-18/h6-11H,1-5H3 |
| InChIKey | OMVBBIJPEODQEO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |