C17H15F2NO — CID 46089033
5-tert-butyl-2-(3,5-difluorophenyl)-1,3-benzoxazole (PubChem CID 46089033) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-tert-butyl-2-(3,5-difluorophenyl)-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-(3,5-difluorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 46089033 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-tert-butyl-2-(3,5-difluorophenyl)-1,3-benzoxazole |
| SMILES | CC(C)(C)c1ccc2oc(-c3cc(F)cc(F)c3)nc2c1 |
| InChI | InChI=1S/C17H15F2NO/c1-17(2,3)11-4-5-15-14(8-11)20-16(21-15)10-6-12(18)9-13(19)7-10/h4-9H,1-3H3 |
| InChIKey | PJYOYCYGUSYELU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |