C20H23NO3 — CID 53418546
5-tert-butyl-2-[(2,5-dimethoxyphenyl)methyl]-1,3-benzoxazole (PubChem CID 53418546) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 5-tert-butyl-2-[(2,5-dimethoxyphenyl)methyl]-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-[(2,5-dimethoxyphenyl)methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 53418546 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 5-tert-butyl-2-[(2,5-dimethoxyphenyl)methyl]-1,3-benzoxazole |
| SMILES | COc1ccc(OC)c(Cc2nc3cc(C(C)(C)C)ccc3o2)c1 |
| InChI | InChI=1S/C20H23NO3/c1-20(2,3)14-6-8-18-16(12-14)21-19(24-18)11-13-10-15(22-4)7-9-17(13)23-5/h6-10,12H,11H2,1-5H3 |
| InChIKey | ZOXPGHPOTVEWEV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |