C14H19NO2 — CID 11276348
2-hexyl-5-methoxy-1,3-benzoxazole (PubChem CID 11276348) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-hexyl-5-methoxy-1,3-benzoxazole.
| Compound Name | 2-hexyl-5-methoxy-1,3-benzoxazole |
|---|---|
| PubChem CID | 11276348 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-hexyl-5-methoxy-1,3-benzoxazole |
| SMILES | CCCCCCc1nc2cc(OC)ccc2o1 |
| InChI | InChI=1S/C14H19NO2/c1-3-4-5-6-7-14-15-12-10-11(16-2)8-9-13(12)17-14/h8-10H,3-7H2,1-2H3 |
| InChIKey | ARSPTLUZRONBIV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|