C12H14BrNO2 — CID 89057547
2-(bromomethyl)-5-butoxy-1,3-benzoxazole (PubChem CID 89057547) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-(bromomethyl)-5-butoxy-1,3-benzoxazole.
| Compound Name | 2-(bromomethyl)-5-butoxy-1,3-benzoxazole |
|---|---|
| PubChem CID | 89057547 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-(bromomethyl)-5-butoxy-1,3-benzoxazole |
| SMILES | CCCCOc1ccc2oc(CBr)nc2c1 |
| InChI | InChI=1S/C12H14BrNO2/c1-2-3-6-15-9-4-5-11-10(7-9)14-12(8-13)16-11/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | HASLVNWNCGIAAW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|