C18H19NO3 — CID 90435284
8-butoxy-1,4-dimethylphenoxazin-3-one (PubChem CID 90435284) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 8-butoxy-1,4-dimethylphenoxazin-3-one.
| Compound Name | 8-butoxy-1,4-dimethylphenoxazin-3-one |
|---|---|
| PubChem CID | 90435284 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 8-butoxy-1,4-dimethylphenoxazin-3-one |
| SMILES | CCCCOc1ccc2oc3c(C)c(=O)cc(C)c-3nc2c1 |
| InChI | InChI=1S/C18H19NO3/c1-4-5-8-21-13-6-7-16-14(10-13)19-17-11(2)9-15(20)12(3)18(17)22-16/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | IKENEUVAFDJWCP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|