C20H30O3 — CID 161038813
acetaldehyde;2,3-dimethyl-5-octoxy-1-benzofuran (PubChem CID 161038813) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is acetaldehyde;2,3-dimethyl-5-octoxy-1-benzofuran.
| Compound Name | acetaldehyde;2,3-dimethyl-5-octoxy-1-benzofuran |
|---|---|
| PubChem CID | 161038813 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | acetaldehyde;2,3-dimethyl-5-octoxy-1-benzofuran |
| SMILES | CC=O.CCCCCCCCOc1ccc2oc(C)c(C)c2c1 |
| InChI | InChI=1S/C18H26O2.C2H4O/c1-4-5-6-7-8-9-12-19-16-10-11-18-17(13-16)14(2)15(3)20-18;1-2-3/h10-11,13H,4-9,12H2,1-3H3;2H,1H3 |
| InChIKey | UAPMODCHJHYLQL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|