C22H24O3 — CID 86159473
3-benzyl-2-methyl-7-pentoxychromen-4-one (PubChem CID 86159473) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-benzyl-2-methyl-7-pentoxychromen-4-one.
| Compound Name | 3-benzyl-2-methyl-7-pentoxychromen-4-one |
|---|---|
| PubChem CID | 86159473 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-benzyl-2-methyl-7-pentoxychromen-4-one |
| SMILES | CCCCCOc1ccc2c(=O)c(Cc3ccccc3)c(C)oc2c1 |
| InChI | InChI=1S/C22H24O3/c1-3-4-8-13-24-18-11-12-19-21(15-18)25-16(2)20(22(19)23)14-17-9-6-5-7-10-17/h5-7,9-12,15H,3-4,8,13-14H2,1-2H3 |
| InChIKey | JRKMKEOSWHIEHW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|