C34H32N2O6S — CID 135294656
2-(4-butoxyphenyl)-5-[[2-(4-butoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole (PubChem CID 135294656) has the molecular formula C34H32N2O6S and a molecular weight of 596.71 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-[[2-(4-butoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole.
| Compound Name | 2-(4-butoxyphenyl)-5-[[2-(4-butoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 135294656 |
| Molecular Formula | C34H32N2O6S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-[[2-(4-butoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole |
| SMILES | CCCCOc1ccc(-c2nc3cc(S(=O)(=O)c4ccc5oc(-c6ccc(OCCCC)cc6)nc5c4)ccc3o2)cc1 |
| InChI | InChI=1S/C34H32N2O6S/c1-3-5-19-39-25-11-7-23(8-12-25)33-35-29-21-27(15-17-31(29)41-33)43(37,38)28-16-18-32-30(22-28)36-34(42-32)24-9-13-26(14-10-24)40-20-6-4-2/h7-18,21-22H,3-6,19-20H2,1-2H3 |
| InChIKey | SOZVTMSYODCFNU-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|