C32H24N2O6S — CID 135296215
2-(4-prop-2-enoxyphenyl)-5-[[2-(4-prop-2-enoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole (PubChem CID 135296215) has the molecular formula C32H24N2O6S and a molecular weight of 564.62 g/mol. Its IUPAC name is 2-(4-prop-2-enoxyphenyl)-5-[[2-(4-prop-2-enoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole.
| Compound Name | 2-(4-prop-2-enoxyphenyl)-5-[[2-(4-prop-2-enoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 135296215 |
| Molecular Formula | C32H24N2O6S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 2-(4-prop-2-enoxyphenyl)-5-[[2-(4-prop-2-enoxyphenyl)-1,3-benzoxazol-5-yl]sulfonyl]-1,3-benzoxazole |
| SMILES | C=CCOc1ccc(-c2nc3cc(S(=O)(=O)c4ccc5oc(-c6ccc(OCC=C)cc6)nc5c4)ccc3o2)cc1 |
| InChI | InChI=1S/C32H24N2O6S/c1-3-17-37-23-9-5-21(6-10-23)31-33-27-19-25(13-15-29(27)39-31)41(35,36)26-14-16-30-28(20-26)34-32(40-30)22-7-11-24(12-8-22)38-18-4-2/h3-16,19-20H,1-2,17-18H2 |
| InChIKey | KHCGROMHGNAZFS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|