C26H16F6N2O3 — CID 155173770
5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-enoxyphenyl)-1,3-benzoxazole (PubChem CID 155173770) has the molecular formula C26H16F6N2O3 and a molecular weight of 518.41 g/mol. Its IUPAC name is 5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-enoxyphenyl)-1,3-benzoxazole.
| Compound Name | 5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-enoxyphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 155173770 |
| Molecular Formula | C26H16F6N2O3 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-enoxyphenyl)-1,3-benzoxazole |
| SMILES | C=CCOc1ccc(-c2nc3cc(C(c4ccc5ocnc5c4)(C(F)(F)F)C(F)(F)F)ccc3o2)cc1 |
| InChI | InChI=1S/C26H16F6N2O3/c1-2-11-35-18-7-3-15(4-8-18)23-34-20-13-17(6-10-22(20)37-23)24(25(27,28)29,26(30,31)32)16-5-9-21-19(12-16)33-14-36-21/h2-10,12-14H,1,11H2 |
| InChIKey | JKYAJRMYGNZVMI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|