C21H18Cl6O2 — CID 139776555
1-[1,1,1,3,3,3-hexachloro-2-(4-prop-2-enoxyphenyl)propan-2-yl]-4-prop-2-enoxybenzene (PubChem CID 139776555) has the molecular formula C21H18Cl6O2 and a molecular weight of 515.09 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexachloro-2-(4-prop-2-enoxyphenyl)propan-2-yl]-4-prop-2-enoxybenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexachloro-2-(4-prop-2-enoxyphenyl)propan-2-yl]-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 139776555 |
| Molecular Formula | C21H18Cl6O2 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexachloro-2-(4-prop-2-enoxyphenyl)propan-2-yl]-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C(c2ccc(OCC=C)cc2)(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H18Cl6O2/c1-3-13-28-17-9-5-15(6-10-17)19(20(22,23)24,21(25,26)27)16-7-11-18(12-8-16)29-14-4-2/h3-12H,1-2,13-14H2 |
| InChIKey | FLWLDKCQXIAYPH-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|