C23H12F6N2O3 — CID 136835633
2-[5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazol-2-yl]phenol (PubChem CID 136835633) has the molecular formula C23H12F6N2O3 and a molecular weight of 478.35 g/mol. Its IUPAC name is 2-[5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazol-2-yl]phenol.
| Compound Name | 2-[5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazol-2-yl]phenol |
|---|---|
| PubChem CID | 136835633 |
| Molecular Formula | C23H12F6N2O3 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-[5-[2-(1,3-benzoxazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2cc(C(c3ccc4ocnc4c3)(C(F)(F)F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C23H12F6N2O3/c24-22(25,26)21(23(27,28)29,12-5-7-18-15(9-12)30-11-33-18)13-6-8-19-16(10-13)31-20(34-19)14-3-1-2-4-17(14)32/h1-11,32H |
| InChIKey | RJDYFLIDJKRMAP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |