C30H18F6N2O2 — CID 144938043
5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]propan-2-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 144938043) has the molecular formula C30H18F6N2O2 and a molecular weight of 552.47 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]propan-2-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]propan-2-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 144938043 |
| Molecular Formula | C30H18F6N2O2 |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]propan-2-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | Cc1ccc(-c2nc3cc(C(c4ccc5oc(-c6ccccc6)nc5c4)(C(F)(F)F)C(F)(F)F)ccc3o2)cc1 |
| InChI | InChI=1S/C30H18F6N2O2/c1-17-7-9-19(10-8-17)27-38-23-16-21(12-14-25(23)40-27)28(29(31,32)33,30(34,35)36)20-11-13-24-22(15-20)37-26(39-24)18-5-3-2-4-6-18/h2-16H,1H3 |
| InChIKey | OWDRGEJFLWDYCT-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |