C16H12F3NO2S — CID 118035627
2-(4-ethylsulfinylphenyl)-5-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 118035627) has the molecular formula C16H12F3NO2S and a molecular weight of 339.34 g/mol. Its IUPAC name is 2-(4-ethylsulfinylphenyl)-5-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 2-(4-ethylsulfinylphenyl)-5-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 118035627 |
| Molecular Formula | C16H12F3NO2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-(4-ethylsulfinylphenyl)-5-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | CCS(=O)c1ccc(-c2nc3cc(C(F)(F)F)ccc3o2)cc1 |
| InChI | InChI=1S/C16H12F3NO2S/c1-2-23(21)12-6-3-10(4-7-12)15-20-13-9-11(16(17,18)19)5-8-14(13)22-15/h3-9H,2H2,1H3 |
| InChIKey | BVKMKKNSFCTCFV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |