C22H23NO3 — CID 59705629
[4-[5-(2-methylbutan-2-yl)-1,3-benzoxazol-2-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 59705629) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [4-[5-(2-methylbutan-2-yl)-1,3-benzoxazol-2-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[5-(2-methylbutan-2-yl)-1,3-benzoxazol-2-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59705629 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [4-[5-(2-methylbutan-2-yl)-1,3-benzoxazol-2-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2nc3cc(C(C)(C)CC)ccc3o2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-6-22(4,5)16-9-12-19-18(13-16)23-20(26-19)15-7-10-17(11-8-15)25-21(24)14(2)3/h7-13H,2,6H2,1,3-5H3 |
| InChIKey | COMQDHAIBGMIGD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|