2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid

C16H13NO4 — CID 82036585

IUPAC2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid
SMILESCOc1ccc(-c2nc3cc(CC(=O)O)ccc3o2)cc1
InChIInChI=1S/C16H13NO4/c1-20-12-5-3-11(4-6-12)16-17-13-8-10(9-15(18)19)2-7-14(13)21-16/h2-8H,9H2,1H3,(H,18,19)
InChIKeyANHMYRPCGXMUGN-UHFFFAOYSA-N
MW283.28 g/mol
LogP3.13
Rot. Bonds4

About 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid

2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid (PubChem CID 82036585) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid
PubChem CID82036585
Molecular FormulaC16H13NO4
Molecular Weight283.28 g/mol
Exact Mass283.08
IUPAC Name2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid
SMILESCOc1ccc(-c2nc3cc(CC(=O)O)ccc3o2)cc1
InChIInChI=1S/C16H13NO4/c1-20-12-5-3-11(4-6-12)16-17-13-8-10(9-15(18)19)2-7-14(13)21-16/h2-8H,9H2,1H3,(H,18,19)
InChIKeyANHMYRPCGXMUGN-UHFFFAOYSA-N
XLogP3.13
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid?
The IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid (CID 82036585) is 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid is COc1ccc(-c2nc3cc(CC(=O)O)ccc3o2)cc1.
What is the InChIKey of 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid?
The InChIKey is ANHMYRPCGXMUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-20-12-5-3-11(4-6-12)16-17-13-8-10(9-15(18)19)2-7-14(13)21-16/h2-8H,9H2,1H3,(H,18,19).
What are the key properties of 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid?
2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid has a molecular weight of 283.28 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]acetic acid is sourced from PubChem (CID 82036585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).