C18H24O4 — CID 167317201
[3-[4-(2-methylbutan-2-yl)phenoxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 167317201) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [3-[4-(2-methylbutan-2-yl)phenoxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-(2-methylbutan-2-yl)phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167317201 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [3-[4-(2-methylbutan-2-yl)phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)Oc1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C18H24O4/c1-6-18(4,5)14-7-9-15(10-8-14)22-16(19)11-12-21-17(20)13(2)3/h7-10H,2,6,11-12H2,1,3-5H3 |
| InChIKey | CUYFQWKMEWVRKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|