C19H20NO4S+ — CID 122705085
[3-[4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 122705085) has the molecular formula C19H20NO4S+ and a molecular weight of 358.44 g/mol. Its IUPAC name is [3-[4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122705085 |
| Molecular Formula | C19H20NO4S+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [3-[4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]phenoxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)Oc1ccc(C=Cc2scc[n+]2C)cc1 |
| InChI | InChI=1S/C19H20NO4S/c1-14(2)19(22)23-12-10-18(21)24-16-7-4-15(5-8-16)6-9-17-20(3)11-13-25-17/h4-9,11,13H,1,10,12H2,2-3H3/q+1 |
| InChIKey | WKSXMYLDWFXUJL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|