C15H22N2O — CID 81072191
3-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-methylpropan-1-amine (PubChem CID 81072191) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-methylpropan-1-amine.
| Compound Name | 3-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 81072191 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-methylpropan-1-amine |
| SMILES | CC(CN)Cc1nc2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C15H22N2O/c1-10(9-16)7-14-17-12-8-11(15(2,3)4)5-6-13(12)18-14/h5-6,8,10H,7,9,16H2,1-4H3 |
| InChIKey | QUYSGIATDGXMDP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |