C18H28N2O2 — CID 70177904
(2R)-2-amino-1-(5-tert-butyl-1,3-benzoxazol-2-yl)-4-methylhexan-1-ol (PubChem CID 70177904) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2R)-2-amino-1-(5-tert-butyl-1,3-benzoxazol-2-yl)-4-methylhexan-1-ol.
| Compound Name | (2R)-2-amino-1-(5-tert-butyl-1,3-benzoxazol-2-yl)-4-methylhexan-1-ol |
|---|---|
| PubChem CID | 70177904 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2R)-2-amino-1-(5-tert-butyl-1,3-benzoxazol-2-yl)-4-methylhexan-1-ol |
| SMILES | CCC(C)C[C@@H](N)C(O)c1nc2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C18H28N2O2/c1-6-11(2)9-13(19)16(21)17-20-14-10-12(18(3,4)5)7-8-15(14)22-17/h7-8,10-11,13,16,21H,6,9,19H2,1-5H3/t11?,13-,16?/m1/s1 |
| InChIKey | YMTHEVOUNYORFC-RYCVTPFZSA-N |
| XLogP | 3.92 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |