About 2-benzyl-1,3-benzoxazol-6-amine
2-benzyl-1,3-benzoxazol-6-amine (PubChem CID 39112088) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-benzyl-1,3-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 2-benzyl-1,3-benzoxazol-6-amine |
| PubChem CID | 39112088 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-benzyl-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(Cc3ccccc3)oc2c1 |
| InChI | InChI=1S/C14H12N2O/c15-11-6-7-12-13(9-11)17-14(16-12)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2 |
| InChIKey | MYJXYQISQKRASX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,3-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,3-benzoxazol-6-amine?
The IUPAC name of 2-benzyl-1,3-benzoxazol-6-amine (CID 39112088) is 2-benzyl-1,3-benzoxazol-6-amine.
What is the SMILES notation for 2-benzyl-1,3-benzoxazol-6-amine?
The canonical SMILES for 2-benzyl-1,3-benzoxazol-6-amine is Nc1ccc2nc(Cc3ccccc3)oc2c1.
What is the InChIKey of 2-benzyl-1,3-benzoxazol-6-amine?
The InChIKey is MYJXYQISQKRASX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c15-11-6-7-12-13(9-11)17-14(16-12)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2.
What are the key properties of 2-benzyl-1,3-benzoxazol-6-amine?
2-benzyl-1,3-benzoxazol-6-amine has a molecular weight of 224.26 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,3-benzoxazol-6-amine is sourced from PubChem (CID 39112088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).