C12H16N2O — CID 112694836
2-(2-methylbutyl)-1,3-benzoxazol-6-amine (PubChem CID 112694836) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(2-methylbutyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(2-methylbutyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 112694836 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(2-methylbutyl)-1,3-benzoxazol-6-amine |
| SMILES | CCC(C)Cc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C12H16N2O/c1-3-8(2)6-12-14-10-5-4-9(13)7-11(10)15-12/h4-5,7-8H,3,6,13H2,1-2H3 |
| InChIKey | VPGUQKSEPZBPIM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|