C12H15BrN2O — CID 114874873
5-bromo-2-(2-methylbutyl)-1,3-benzoxazol-7-amine (PubChem CID 114874873) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 5-bromo-2-(2-methylbutyl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(2-methylbutyl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 114874873 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-bromo-2-(2-methylbutyl)-1,3-benzoxazol-7-amine |
| SMILES | CCC(C)Cc1nc2cc(Br)cc(N)c2o1 |
| InChI | InChI=1S/C12H15BrN2O/c1-3-7(2)4-11-15-10-6-8(13)5-9(14)12(10)16-11/h5-7H,3-4,14H2,1-2H3 |
| InChIKey | CAWBAGBCOQHFFF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|