C11H13BrN2O — CID 104728838
5-bromo-2-butyl-1,3-benzoxazol-7-amine (PubChem CID 104728838) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-bromo-2-butyl-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-butyl-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728838 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-bromo-2-butyl-1,3-benzoxazol-7-amine |
| SMILES | CCCCc1nc2cc(Br)cc(N)c2o1 |
| InChI | InChI=1S/C11H13BrN2O/c1-2-3-4-10-14-9-6-7(12)5-8(13)11(9)15-10/h5-6H,2-4,13H2,1H3 |
| InChIKey | IKOVABZCHOEZFO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|