C14H13BrN2O2 — CID 104728797
5-bromo-2-(2,4,5-trimethylfuran-3-yl)-1,3-benzoxazol-7-amine (PubChem CID 104728797) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-bromo-2-(2,4,5-trimethylfuran-3-yl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(2,4,5-trimethylfuran-3-yl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728797 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-bromo-2-(2,4,5-trimethylfuran-3-yl)-1,3-benzoxazol-7-amine |
| SMILES | Cc1oc(C)c(-c2nc3cc(Br)cc(N)c3o2)c1C |
| InChI | InChI=1S/C14H13BrN2O2/c1-6-7(2)18-8(3)12(6)14-17-11-5-9(15)4-10(16)13(11)19-14/h4-5H,16H2,1-3H3 |
| InChIKey | APHNUPOOPHTMCJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|