C13H11BrN2O2 — CID 104728960
5-bromo-2-(5-ethylfuran-2-yl)-1,3-benzoxazol-7-amine (PubChem CID 104728960) has the molecular formula C13H11BrN2O2 and a molecular weight of 307.15 g/mol. Its IUPAC name is 5-bromo-2-(5-ethylfuran-2-yl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(5-ethylfuran-2-yl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728960 |
| Molecular Formula | C13H11BrN2O2 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 5-bromo-2-(5-ethylfuran-2-yl)-1,3-benzoxazol-7-amine |
| SMILES | CCc1ccc(-c2nc3cc(Br)cc(N)c3o2)o1 |
| InChI | InChI=1S/C13H11BrN2O2/c1-2-8-3-4-11(17-8)13-16-10-6-7(14)5-9(15)12(10)18-13/h3-6H,2,15H2,1H3 |
| InChIKey | CXMGPWVASOQPSM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|