C13H7Br2ClN2O — CID 107939138
5-bromo-2-(3-bromo-5-chlorophenyl)-1,3-benzoxazol-7-amine (PubChem CID 107939138) has the molecular formula C13H7Br2ClN2O and a molecular weight of 402.47 g/mol. Its IUPAC name is 5-bromo-2-(3-bromo-5-chlorophenyl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(3-bromo-5-chlorophenyl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 107939138 |
| Molecular Formula | C13H7Br2ClN2O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 399.86 |
| IUPAC Name | 5-bromo-2-(3-bromo-5-chlorophenyl)-1,3-benzoxazol-7-amine |
| SMILES | Nc1cc(Br)cc2nc(-c3cc(Cl)cc(Br)c3)oc12 |
| InChI | InChI=1S/C13H7Br2ClN2O/c14-7-1-6(2-9(16)3-7)13-18-11-5-8(15)4-10(17)12(11)19-13/h1-5H,17H2 |
| InChIKey | AXHOINISYWUFID-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|