C13H6BrF3N2O — CID 104728988
5-bromo-2-(2,4,6-trifluorophenyl)-1,3-benzoxazol-7-amine (PubChem CID 104728988) has the molecular formula C13H6BrF3N2O and a molecular weight of 343.10 g/mol. Its IUPAC name is 5-bromo-2-(2,4,6-trifluorophenyl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(2,4,6-trifluorophenyl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728988 |
| Molecular Formula | C13H6BrF3N2O |
| Molecular Weight | 343.10 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 5-bromo-2-(2,4,6-trifluorophenyl)-1,3-benzoxazol-7-amine |
| SMILES | Nc1cc(Br)cc2nc(-c3c(F)cc(F)cc3F)oc12 |
| InChI | InChI=1S/C13H6BrF3N2O/c14-5-1-9(18)12-10(2-5)19-13(20-12)11-7(16)3-6(15)4-8(11)17/h1-4H,18H2 |
| InChIKey | HNGDLOXRKAHGOV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.10 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|