C17H17BrN2O — CID 104728796
5-bromo-2-(4-tert-butylphenyl)-1,3-benzoxazol-7-amine (PubChem CID 104728796) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is 5-bromo-2-(4-tert-butylphenyl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(4-tert-butylphenyl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728796 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 5-bromo-2-(4-tert-butylphenyl)-1,3-benzoxazol-7-amine |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc(Br)cc(N)c3o2)cc1 |
| InChI | InChI=1S/C17H17BrN2O/c1-17(2,3)11-6-4-10(5-7-11)16-20-14-9-12(18)8-13(19)15(14)21-16/h4-9H,19H2,1-3H3 |
| InChIKey | UXEHECDJEKFHHZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|