C15H21BrN2O — CID 104728776
5-bromo-2-(2,4,4-trimethylpentyl)-1,3-benzoxazol-7-amine (PubChem CID 104728776) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-bromo-2-(2,4,4-trimethylpentyl)-1,3-benzoxazol-7-amine.
| Compound Name | 5-bromo-2-(2,4,4-trimethylpentyl)-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 104728776 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-bromo-2-(2,4,4-trimethylpentyl)-1,3-benzoxazol-7-amine |
| SMILES | CC(Cc1nc2cc(Br)cc(N)c2o1)CC(C)(C)C |
| InChI | InChI=1S/C15H21BrN2O/c1-9(8-15(2,3)4)5-13-18-12-7-10(16)6-11(17)14(12)19-13/h6-7,9H,5,8,17H2,1-4H3 |
| InChIKey | UKPWMCYVZSWQFZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|