C12H15FN2O — CID 82231108
2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazol-7-amine (PubChem CID 82231108) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazol-7-amine.
| Compound Name | 2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 82231108 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazol-7-amine |
| SMILES | CC(C)(C)Cc1nc2cc(F)cc(N)c2o1 |
| InChI | InChI=1S/C12H15FN2O/c1-12(2,3)6-10-15-9-5-7(13)4-8(14)11(9)16-10/h4-5H,6,14H2,1-3H3 |
| InChIKey | NPACCTOJYCSTDH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|