C15H22N2O — CID 82232206
2-(2,2-dimethylpropyl)-5-propyl-1,3-benzoxazol-7-amine (PubChem CID 82232206) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-5-propyl-1,3-benzoxazol-7-amine.
| Compound Name | 2-(2,2-dimethylpropyl)-5-propyl-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 82232206 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-5-propyl-1,3-benzoxazol-7-amine |
| SMILES | CCCc1cc(N)c2oc(CC(C)(C)C)nc2c1 |
| InChI | InChI=1S/C15H22N2O/c1-5-6-10-7-11(16)14-12(8-10)17-13(18-14)9-15(2,3)4/h7-8H,5-6,9,16H2,1-4H3 |
| InChIKey | SWQLXKJLWVUEQK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|