C14H20N2O — CID 94977224
5-butyl-2-propyl-1,3-benzoxazol-7-amine (PubChem CID 94977224) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-butyl-2-propyl-1,3-benzoxazol-7-amine.
| Compound Name | 5-butyl-2-propyl-1,3-benzoxazol-7-amine |
|---|---|
| PubChem CID | 94977224 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-butyl-2-propyl-1,3-benzoxazol-7-amine |
| SMILES | CCCCc1cc(N)c2oc(CCC)nc2c1 |
| InChI | InChI=1S/C14H20N2O/c1-3-5-7-10-8-11(15)14-12(9-10)16-13(17-14)6-4-2/h8-9H,3-7,15H2,1-2H3 |
| InChIKey | BFSCAJDVKANCLS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|